C19H18Cl2NO3P — CID 11864836
(E)-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]-3-phenylprop-2-enamide (PubChem CID 11864836) has the molecular formula C19H18Cl2NO3P and a molecular weight of 410.24 g/mol. Its IUPAC name is (E)-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11864836 |
| Molecular Formula | C19H18Cl2NO3P |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (E)-N-[2,2-dichloro-1-[ethoxy(phenyl)phosphoryl]ethenyl]-3-phenylprop-2-enamide |
| SMILES | CCO[P@](=O)(C(NC(=O)/C=C/c1ccccc1)=C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C19H18Cl2NO3P/c1-2-25-26(24,16-11-7-4-8-12-16)19(18(20)21)22-17(23)14-13-15-9-5-3-6-10-15/h3-14H,2H2,1H3,(H,22,23)/b14-13+/t26-/m0/s1 |
| InChIKey | JKVDAQFPIDSSHK-ODUIWNOOSA-N |
| XLogP | 5.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|