C16H21O5PS — CID 134932310
S-[(1Z,3E)-2-diethoxyphosphoryloxy-4-phenylbuta-1,3-dienyl] ethanethioate (PubChem CID 134932310) has the molecular formula C16H21O5PS and a molecular weight of 356.38 g/mol. Its IUPAC name is S-[(1Z,3E)-2-diethoxyphosphoryloxy-4-phenylbuta-1,3-dienyl] ethanethioate.
| Compound Name | S-[(1Z,3E)-2-diethoxyphosphoryloxy-4-phenylbuta-1,3-dienyl] ethanethioate |
|---|---|
| PubChem CID | 134932310 |
| Molecular Formula | C16H21O5PS |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | S-[(1Z,3E)-2-diethoxyphosphoryloxy-4-phenylbuta-1,3-dienyl] ethanethioate |
| SMILES | CCOP(=O)(OCC)OC(=C\SC(C)=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H21O5PS/c1-4-19-22(18,20-5-2)21-16(13-23-14(3)17)12-11-15-9-7-6-8-10-15/h6-13H,4-5H2,1-3H3/b12-11+,16-13- |
| InChIKey | DDQDMSHJHRJZKE-SSLWBDRLSA-N |
| XLogP | 5.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|