C18H27O3P — CID 134934285
[(E,3E)-3-(diethoxyphosphorylmethylidene)hept-1-enyl]benzene (PubChem CID 134934285) has the molecular formula C18H27O3P and a molecular weight of 322.38 g/mol. Its IUPAC name is [(E,3E)-3-(diethoxyphosphorylmethylidene)hept-1-enyl]benzene.
| Compound Name | [(E,3E)-3-(diethoxyphosphorylmethylidene)hept-1-enyl]benzene |
|---|---|
| PubChem CID | 134934285 |
| Molecular Formula | C18H27O3P |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [(E,3E)-3-(diethoxyphosphorylmethylidene)hept-1-enyl]benzene |
| SMILES | CCCCC(/C=C/c1ccccc1)=C\P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H27O3P/c1-4-7-11-18(15-14-17-12-9-8-10-13-17)16-22(19,20-5-2)21-6-3/h8-10,12-16H,4-7,11H2,1-3H3/b15-14+,18-16+ |
| InChIKey | UIUZEUXVUNVQEY-IFABNPKTSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|