C19H27O4P — CID 11810245
(E,4E)-4-(diethoxyphosphorylmethylidene)-1-phenyloct-1-en-3-one (PubChem CID 11810245) has the molecular formula C19H27O4P and a molecular weight of 350.40 g/mol. Its IUPAC name is (E,4E)-4-(diethoxyphosphorylmethylidene)-1-phenyloct-1-en-3-one.
| Compound Name | (E,4E)-4-(diethoxyphosphorylmethylidene)-1-phenyloct-1-en-3-one |
|---|---|
| PubChem CID | 11810245 |
| Molecular Formula | C19H27O4P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E,4E)-4-(diethoxyphosphorylmethylidene)-1-phenyloct-1-en-3-one |
| SMILES | CCCC/C(=C\P(=O)(OCC)OCC)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H27O4P/c1-4-7-13-18(16-24(21,22-5-2)23-6-3)19(20)15-14-17-11-9-8-10-12-17/h8-12,14-16H,4-7,13H2,1-3H3/b15-14+,18-16+ |
| InChIKey | HMJOCFPTGIEJEN-IFABNPKTSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|