About [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate
[(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate (PubChem CID 11120882) has the molecular formula C16H21O5P
and a molecular weight of 324.31 g/mol. Its IUPAC name is [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate.
Molecular Properties
| Compound Name | [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate |
| PubChem CID | 11120882 |
| Molecular Formula | C16H21O5P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate |
| SMILES | CCOP(=O)(OCC)C(/C=C/c1ccccc1)=C/OC(C)=O |
| InChI | InChI=1S/C16H21O5P/c1-4-20-22(18,21-5-2)16(13-19-14(3)17)12-11-15-9-7-6-8-10-15/h6-13H,4-5H2,1-3H3/b12-11+,16-13+ |
| InChIKey | IOASCGXKZBISEX-VUWKKMCJSA-N |
| XLogP | 4.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate?
The IUPAC name of [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate (CID 11120882) is [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate.
What is the SMILES notation for [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate?
The canonical SMILES for [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate is CCOP(=O)(OCC)C(/C=C/c1ccccc1)=C/OC(C)=O.
What is the InChIKey of [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate?
The InChIKey is IOASCGXKZBISEX-VUWKKMCJSA-N. The full InChI is InChI=1S/C16H21O5P/c1-4-20-22(18,21-5-2)16(13-19-14(3)17)12-11-15-9-7-6-8-10-15/h6-13H,4-5H2,1-3H3/b12-11+,16-13+.
What are the key properties of [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate?
[(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate has a molecular weight of 324.31 g/mol, XLogP of 4.37, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-2-diethoxyphosphoryl-4-phenylbuta-1,3-dienyl] acetate is sourced from PubChem (CID 11120882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).