C14H18FO3P — CID 135002683
[(1E,3Z)-4-diethoxyphosphoryl-4-fluorobuta-1,3-dienyl]benzene (PubChem CID 135002683) has the molecular formula C14H18FO3P and a molecular weight of 284.27 g/mol. Its IUPAC name is [(1E,3Z)-4-diethoxyphosphoryl-4-fluorobuta-1,3-dienyl]benzene.
| Compound Name | [(1E,3Z)-4-diethoxyphosphoryl-4-fluorobuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 135002683 |
| Molecular Formula | C14H18FO3P |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [(1E,3Z)-4-diethoxyphosphoryl-4-fluorobuta-1,3-dienyl]benzene |
| SMILES | CCOP(=O)(OCC)/C(F)=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C14H18FO3P/c1-3-17-19(16,18-4-2)14(15)12-8-11-13-9-6-5-7-10-13/h5-12H,3-4H2,1-2H3/b11-8+,14-12- |
| InChIKey | ZSJLTADXDQSBNT-FENWIEIGSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|