About 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene
1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene (PubChem CID 102126410) has the molecular formula C18H27BrO6P2
and a molecular weight of 481.26 g/mol. Its IUPAC name is 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene.
Molecular Properties
| Compound Name | 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene |
| PubChem CID | 102126410 |
| Molecular Formula | C18H27BrO6P2 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene |
| SMILES | CCOP(=O)(OCC)C(=C/C=C/c1cccc(Br)c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H27BrO6P2/c1-5-22-26(20,23-6-2)18(27(21,24-7-3)25-8-4)14-10-12-16-11-9-13-17(19)15-16/h9-15H,5-8H2,1-4H3/b12-10+ |
| InChIKey | FOVUMTVHTZVHAM-ZRDIBKRKSA-N |
| XLogP | 6.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene?
The IUPAC name of 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene (CID 102126410) is 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene.
What is the SMILES notation for 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene?
The canonical SMILES for 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene is CCOP(=O)(OCC)C(=C/C=C/c1cccc(Br)c1)P(=O)(OCC)OCC.
What is the InChIKey of 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene?
The InChIKey is FOVUMTVHTZVHAM-ZRDIBKRKSA-N. The full InChI is InChI=1S/C18H27BrO6P2/c1-5-22-26(20,23-6-2)18(27(21,24-7-3)25-8-4)14-10-12-16-11-9-13-17(19)15-16/h9-15H,5-8H2,1-4H3/b12-10+.
What are the key properties of 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene?
1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene has a molecular weight of 481.26 g/mol, XLogP of 6.84, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene is sourced from PubChem (CID 102126410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).