C18H27BrO6P2 — CID 102126410
1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene (PubChem CID 102126410) has the molecular formula C18H27BrO6P2 and a molecular weight of 481.26 g/mol. Its IUPAC name is 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene.
| Compound Name | 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene |
|---|---|
| PubChem CID | 102126410 |
| Molecular Formula | C18H27BrO6P2 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-[(1E)-4,4-bis(diethoxyphosphoryl)buta-1,3-dienyl]-3-bromobenzene |
| SMILES | CCOP(=O)(OCC)C(=C/C=C/c1cccc(Br)c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H27BrO6P2/c1-5-22-26(20,23-6-2)18(27(21,24-7-3)25-8-4)14-10-12-16-11-9-13-17(19)15-16/h9-15H,5-8H2,1-4H3/b12-10+ |
| InChIKey | FOVUMTVHTZVHAM-ZRDIBKRKSA-N |
| XLogP | 6.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|