C22H36O6P2 — CID 54046503
4,4-bis[di(propan-2-yloxy)phosphoryl]buta-1,3-dienylbenzene (PubChem CID 54046503) has the molecular formula C22H36O6P2 and a molecular weight of 458.47 g/mol. Its IUPAC name is 4,4-bis[di(propan-2-yloxy)phosphoryl]buta-1,3-dienylbenzene.
| Compound Name | 4,4-bis[di(propan-2-yloxy)phosphoryl]buta-1,3-dienylbenzene |
|---|---|
| PubChem CID | 54046503 |
| Molecular Formula | C22H36O6P2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4,4-bis[di(propan-2-yloxy)phosphoryl]buta-1,3-dienylbenzene |
| SMILES | CC(C)OP(=O)(OC(C)C)C(=CC=Cc1ccccc1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C22H36O6P2/c1-17(2)25-29(23,26-18(3)4)22(16-12-15-21-13-10-9-11-14-21)30(24,27-19(5)6)28-20(7)8/h9-20H,1-8H3 |
| InChIKey | LPXYCVRGGOYAGL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|