C21H33O4P — CID 101157521
(E)-1-cyclohexyl-2-di(propan-2-yloxy)phosphoryl-3-phenylprop-2-en-1-ol (PubChem CID 101157521) has the molecular formula C21H33O4P and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-1-cyclohexyl-2-di(propan-2-yloxy)phosphoryl-3-phenylprop-2-en-1-ol.
| Compound Name | (E)-1-cyclohexyl-2-di(propan-2-yloxy)phosphoryl-3-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 101157521 |
| Molecular Formula | C21H33O4P |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (E)-1-cyclohexyl-2-di(propan-2-yloxy)phosphoryl-3-phenylprop-2-en-1-ol |
| SMILES | CC(C)OP(=O)(OC(C)C)/C(=C/c1ccccc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C21H33O4P/c1-16(2)24-26(23,25-17(3)4)20(15-18-11-7-5-8-12-18)21(22)19-13-9-6-10-14-19/h5,7-8,11-12,15-17,19,21-22H,6,9-10,13-14H2,1-4H3/b20-15+ |
| InChIKey | NWUVJHZNIRFFGQ-HMMYKYKNSA-N |
| XLogP | 6.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|