C18H24O2 — CID 11459971
(E,4R,5S)-5-cyclohexyl-5-hydroxy-4-methyl-1-phenylpent-1-en-3-one (PubChem CID 11459971) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (E,4R,5S)-5-cyclohexyl-5-hydroxy-4-methyl-1-phenylpent-1-en-3-one.
| Compound Name | (E,4R,5S)-5-cyclohexyl-5-hydroxy-4-methyl-1-phenylpent-1-en-3-one |
|---|---|
| PubChem CID | 11459971 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (E,4R,5S)-5-cyclohexyl-5-hydroxy-4-methyl-1-phenylpent-1-en-3-one |
| SMILES | C[C@@H](C(=O)/C=C/c1ccccc1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C18H24O2/c1-14(18(20)16-10-6-3-7-11-16)17(19)13-12-15-8-4-2-5-9-15/h2,4-5,8-9,12-14,16,18,20H,3,6-7,10-11H2,1H3/b13-12+/t14-,18+/m0/s1 |
| InChIKey | KPCMFJJQDPQDRS-VRSLPICJSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|