C21H31N2O2P — CID 5471631
(E)-1-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 5471631) has the molecular formula C21H31N2O2P and a molecular weight of 374.47 g/mol. Its IUPAC name is (E)-1-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5471631 |
| Molecular Formula | C21H31N2O2P |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (E)-1-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | CC(C)N1[C@@H]2CCCC[C@H]2N(C(C)C)P1(=O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H31N2O2P/c1-16(2)22-19-12-8-9-13-20(19)23(17(3)4)26(22,25)21(24)15-14-18-10-6-5-7-11-18/h5-7,10-11,14-17,19-20H,8-9,12-13H2,1-4H3/b15-14+/t19-,20-/m1/s1 |
| InChIKey | VNUQDLGNOLYNBK-ICQOZSIZSA-N |
| XLogP | 5.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|