C21H29NO — CID 110184789
(E)-1-[2-(4-methylcyclohexyl)piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 110184789) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (E)-1-[2-(4-methylcyclohexyl)piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2-(4-methylcyclohexyl)piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 110184789 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (E)-1-[2-(4-methylcyclohexyl)piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | CC1CCC(C2CCCCN2C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C21H29NO/c1-17-10-13-19(14-11-17)20-9-5-6-16-22(20)21(23)15-12-18-7-3-2-4-8-18/h2-4,7-8,12,15,17,19-20H,5-6,9-11,13-14,16H2,1H3/b15-12+ |
| InChIKey | SKBUDPNNHIMZMT-NTCAYCPXSA-N |
| XLogP | 4.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|