C18H21N3O — CID 110104334
(E)-1-[2-(1,4-dimethylimidazol-2-yl)pyrrolidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 110104334) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is (E)-1-[2-(1,4-dimethylimidazol-2-yl)pyrrolidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2-(1,4-dimethylimidazol-2-yl)pyrrolidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 110104334 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (E)-1-[2-(1,4-dimethylimidazol-2-yl)pyrrolidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1cn(C)c(C2CCCN2C(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3O/c1-14-13-20(2)18(19-14)16-9-6-12-21(16)17(22)11-10-15-7-4-3-5-8-15/h3-5,7-8,10-11,13,16H,6,9,12H2,1-2H3/b11-10+ |
| InChIKey | RKMLOBPNKMPFQX-ZHACJKMWSA-N |
| XLogP | 3.11 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|