C22H22N4O2 — CID 125007040
(E)-1-[(2S)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 125007040) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is (E)-1-[(2S)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2S)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 125007040 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (E)-1-[(2S)-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrimidin-4-yl]pyrrolidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1noc(C)c1-c1nccc([C@@H]2CCCN2C(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C22H22N4O2/c1-15-21(16(2)28-25-15)22-23-13-12-18(24-22)19-9-6-14-26(19)20(27)11-10-17-7-4-3-5-8-17/h3-5,7-8,10-13,19H,6,9,14H2,1-2H3/b11-10+/t19-/m0/s1 |
| InChIKey | UKOYKGWZPLZMOT-VYENPZKTSA-N |
| XLogP | 4.13 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|