C17H17N3O — CID 125005357
(E)-3-phenyl-1-[(2R)-2-pyrazin-2-ylpyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 125005357) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (E)-3-phenyl-1-[(2R)-2-pyrazin-2-ylpyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[(2R)-2-pyrazin-2-ylpyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 125005357 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (E)-3-phenyl-1-[(2R)-2-pyrazin-2-ylpyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCC[C@@H]1c1cnccn1 |
| InChI | InChI=1S/C17H17N3O/c21-17(9-8-14-5-2-1-3-6-14)20-12-4-7-16(20)15-13-18-10-11-19-15/h1-3,5-6,8-11,13,16H,4,7,12H2/b9-8+/t16-/m1/s1 |
| InChIKey | TYQNKDIBWXBDCY-ROJDOSBLSA-N |
| XLogP | 2.85 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|