C18H17FN2O — CID 42923748
(E)-3-(4-fluorophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 42923748) has the molecular formula C18H17FN2O and a molecular weight of 296.35 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 42923748 |
| Molecular Formula | C18H17FN2O |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C18H17FN2O/c19-16-8-5-14(6-9-16)7-10-18(22)21-12-2-4-17(21)15-3-1-11-20-13-15/h1,3,5-11,13,17H,2,4,12H2/b10-7+ |
| InChIKey | SDPPUWGQCHNFSA-JXMROGBWSA-N |
| XLogP | 3.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|