C21H22FNO2 — CID 46647186
(E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 46647186) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is (E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46647186 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C2CCCN2C(=O)/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H22FNO2/c1-2-25-19-12-8-17(9-13-19)20-4-3-15-23(20)21(24)14-7-16-5-10-18(22)11-6-16/h5-14,20H,2-4,15H2,1H3/b14-7+ |
| InChIKey | DTZHLOKDGDNEGV-VGOFMYFVSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|