C22H25NO3 — CID 55439810
(E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 55439810) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55439810 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (E)-1-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C2CCCN2C(=O)/C=C/c2ccccc2OC)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-3-26-19-13-10-17(11-14-19)20-8-6-16-23(20)22(24)15-12-18-7-4-5-9-21(18)25-2/h4-5,7,9-15,20H,3,6,8,16H2,1-2H3/b15-12+ |
| InChIKey | DKAMEYLDZHUFES-NTCAYCPXSA-N |
| XLogP | 4.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|