C27H24N4O — CID 42921863
(E)-3-(1,3-diphenylpyrazol-4-yl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 42921863) has the molecular formula C27H24N4O and a molecular weight of 420.52 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 42921863 |
| Molecular Formula | C27H24N4O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1ccccc1)N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C27H24N4O/c32-26(30-18-8-14-25(30)22-11-7-17-28-19-22)16-15-23-20-31(24-12-5-2-6-13-24)29-27(23)21-9-3-1-4-10-21/h1-7,9-13,15-17,19-20,25H,8,14,18H2/b16-15+ |
| InChIKey | IVTSEVKVEKGXDF-FOCLMDBBSA-N |
| XLogP | 5.31 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|