C25H24N6O — CID 86881858
(E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1-(3-pyrazol-1-ylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 86881858) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1-(3-pyrazol-1-ylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1-(3-pyrazol-1-ylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86881858 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-1-(3-pyrazol-1-ylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)N1CCCC(n2cccn2)C1 |
| InChI | InChI=1S/C25H24N6O/c32-24(29-15-5-10-23(19-29)30-16-6-14-27-30)12-11-21-18-31(22-8-2-1-3-9-22)28-25(21)20-7-4-13-26-17-20/h1-4,6-9,11-14,16-18,23H,5,10,15,19H2/b12-11+ |
| InChIKey | MCVFYSXBNGMNSX-VAWYXSNFSA-N |
| XLogP | 4.01 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|