C27H25N5O — CID 44522290
3-(1,3-diphenylpyrazol-4-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 44522290) has the molecular formula C27H25N5O and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 44522290 |
| Molecular Formula | C27H25N5O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccccc1)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C27H25N5O/c33-26(31-19-17-30(18-20-31)24-13-15-28-16-14-24)12-11-23-21-32(25-9-5-2-6-10-25)29-27(23)22-7-3-1-4-8-22/h1-16,21H,17-20H2 |
| InChIKey | LDCUONMTARKGPU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|