C30H30N4O — CID 3970759
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 3970759) has the molecular formula C30H30N4O and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3970759 |
| Molecular Formula | C30H30N4O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)C=Cc3cn(-c4ccccc4)nc3-c3ccccc3)CC2)c1C |
| InChI | InChI=1S/C30H30N4O/c1-23-10-9-15-28(24(23)2)32-18-20-33(21-19-32)29(35)17-16-26-22-34(27-13-7-4-8-14-27)31-30(26)25-11-5-3-6-12-25/h3-17,22H,18-21H2,1-2H3 |
| InChIKey | GWIDJXRHOWCHCQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|