C30H34N4O2 — CID 55676240
(E)-3-(1,3-diphenylpyrazol-4-yl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 55676240) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55676240 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CC1CCCN(C(=O)C2CCN(C(=O)/C=C/c3cn(-c4ccccc4)nc3-c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C30H34N4O2/c1-23-9-8-18-33(21-23)30(36)25-16-19-32(20-17-25)28(35)15-14-26-22-34(27-12-6-3-7-13-27)31-29(26)24-10-4-2-5-11-24/h2-7,10-15,22-23,25H,8-9,16-21H2,1H3/b15-14+ |
| InChIKey | QINMOSBUKACUGX-CCEZHUSRSA-N |
| XLogP | 5.05 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|