C27H25N3O — CID 2423864
(Z)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 2423864) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is (Z)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (Z)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 2423864 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (Z)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C\c1cn(-c2ccccc2)nc1-c1ccc2ccccc2c1)N1CCCCC1 |
| InChI | InChI=1S/C27H25N3O/c31-26(29-17-7-2-8-18-29)16-15-24-20-30(25-11-3-1-4-12-25)28-27(24)23-14-13-21-9-5-6-10-22(21)19-23/h1,3-6,9-16,19-20H,2,7-8,17-18H2/b16-15- |
| InChIKey | GBVCEPAFFBNJKS-NXVVXOECSA-N |
| XLogP | 5.72 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|