C26H25N3O — CID 175921342
(Z)-N,N-diethyl-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 175921342) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is (Z)-N,N-diethyl-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-N,N-diethyl-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 175921342 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (Z)-N,N-diethyl-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C\c1cn(-c2ccccc2)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H25N3O/c1-3-28(4-2)25(30)17-16-23-19-29(24-12-6-5-7-13-24)27-26(23)22-15-14-20-10-8-9-11-21(20)18-22/h5-19H,3-4H2,1-2H3/b17-16- |
| InChIKey | GZXIZMLKYDOGQI-MSUUIHNZSA-N |
| XLogP | 5.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|