C32H27N3O4 — CID 174996459
methyl (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate (PubChem CID 174996459) has the molecular formula C32H27N3O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is methyl (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 174996459 |
| Molecular Formula | C32H27N3O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | methyl (2S)-3-(4-hydroxyphenyl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H27N3O4/c1-39-32(38)29(19-22-11-16-28(36)17-12-22)33-30(37)18-15-26-21-35(27-9-3-2-4-10-27)34-31(26)25-14-13-23-7-5-6-8-24(23)20-25/h2-18,20-21,29,36H,19H2,1H3,(H,33,37)/b18-15+/t29-/m0/s1 |
| InChIKey | FDYTUZGRMJQKNS-UUPRAJRISA-N |
| XLogP | 5.31 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|