C27H20ClF2N3O3 — CID 174996417
(2S)-2-[3-[3-(4-chloro-2,6-difluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoylamino]-3-phenylpropanoic acid (PubChem CID 174996417) has the molecular formula C27H20ClF2N3O3 and a molecular weight of 507.92 g/mol. Its IUPAC name is (2S)-2-[3-[3-(4-chloro-2,6-difluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[3-[3-(4-chloro-2,6-difluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174996417 |
| Molecular Formula | C27H20ClF2N3O3 |
| Molecular Weight | 507.92 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (2S)-2-[3-[3-(4-chloro-2,6-difluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1c(F)cc(Cl)cc1F)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H20ClF2N3O3/c28-19-14-21(29)25(22(30)15-19)26-18(16-33(32-26)20-9-5-2-6-10-20)11-12-24(34)31-23(27(35)36)13-17-7-3-1-4-8-17/h1-12,14-16,23H,13H2,(H,31,34)(H,35,36)/t23-/m0/s1 |
| InChIKey | SGOJDVOTECBCOR-QHCPKHFHSA-N |
| XLogP | 5.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|