C30H26ClN5O3 — CID 175455616
methyl 2-[[(Z)-3-[3-(4-aminophenyl)-1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 175455616) has the molecular formula C30H26ClN5O3 and a molecular weight of 540.02 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-[3-(4-aminophenyl)-1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[(Z)-3-[3-(4-aminophenyl)-1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 175455616 |
| Molecular Formula | C30H26ClN5O3 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | methyl 2-[[(Z)-3-[3-(4-aminophenyl)-1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)/C=C\c1cn(-c2cccc(Cl)c2)nc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C30H26ClN5O3/c1-39-30(38)27(15-21-17-33-26-8-3-2-7-25(21)26)34-28(37)14-11-20-18-36(24-6-4-5-22(31)16-24)35-29(20)19-9-12-23(32)13-10-19/h2-14,16-18,27,33H,15,32H2,1H3,(H,34,37)/b14-11- |
| InChIKey | NQNAHIRSYOAXSE-KAMYIIQDSA-N |
| XLogP | 5.17 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|