C31H27ClN4O4 — CID 175455463
methyl 2-[[(E)-3-[1-(3-chlorophenyl)-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 175455463) has the molecular formula C31H27ClN4O4 and a molecular weight of 555.03 g/mol. Its IUPAC name is methyl 2-[[(E)-3-[1-(3-chlorophenyl)-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[(E)-3-[1-(3-chlorophenyl)-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 175455463 |
| Molecular Formula | C31H27ClN4O4 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | methyl 2-[[(E)-3-[1-(3-chlorophenyl)-3-(2-methoxyphenyl)pyrazol-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)/C=C/c1cn(-c2cccc(Cl)c2)nc1-c1ccccc1OC |
| InChI | InChI=1S/C31H27ClN4O4/c1-39-28-13-6-4-11-25(28)30-20(19-36(35-30)23-9-7-8-22(32)17-23)14-15-29(37)34-27(31(38)40-2)16-21-18-33-26-12-5-3-10-24(21)26/h3-15,17-19,27,33H,16H2,1-2H3,(H,34,37)/b15-14+ |
| InChIKey | RYDIQIFHWXQOPN-CCEZHUSRSA-N |
| XLogP | 5.60 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|