C34H28N4O3 — CID 175449819
methyl 3-(1H-indol-3-yl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate (PubChem CID 175449819) has the molecular formula C34H28N4O3 and a molecular weight of 540.62 g/mol. Its IUPAC name is methyl 3-(1H-indol-3-yl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-(1H-indol-3-yl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 175449819 |
| Molecular Formula | C34H28N4O3 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | methyl 3-(1H-indol-3-yl)-2-[[(E)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H28N4O3/c1-41-34(40)31(20-27-21-35-30-14-8-7-13-29(27)30)36-32(39)18-17-26-22-38(28-11-3-2-4-12-28)37-33(26)25-16-15-23-9-5-6-10-24(23)19-25/h2-19,21-22,31,35H,20H2,1H3,(H,36,39)/b18-17+ |
| InChIKey | LFRLVTSVOCXHIZ-ISLYRVAYSA-N |
| XLogP | 6.09 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|