C30H23N3O2 — CID 174996487
(Z)-N-(3-acetylphenyl)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 174996487) has the molecular formula C30H23N3O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174996487 |
| Molecular Formula | C30H23N3O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-3-(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C=C\c2cn(-c3ccccc3)nc2-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C30H23N3O2/c1-21(34)23-10-7-11-27(19-23)31-29(35)17-16-26-20-33(28-12-3-2-4-13-28)32-30(26)25-15-14-22-8-5-6-9-24(22)18-25/h2-20H,1H3,(H,31,35)/b17-16- |
| InChIKey | AFGPYXUMBFAVQK-MSUUIHNZSA-N |
| XLogP | 6.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|