C23H24N4O3 — CID 56557533
ethyl N-[2-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]ethyl]carbamate (PubChem CID 56557533) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl N-[2-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56557533 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | ethyl N-[2-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H24N4O3/c1-2-30-23(29)25-16-15-24-21(28)14-13-19-17-27(20-11-7-4-8-12-20)26-22(19)18-9-5-3-6-10-18/h3-14,17H,2,15-16H2,1H3,(H,24,28)(H,25,29)/b14-13+ |
| InChIKey | SYKIITDQUWQPPT-BUHFOSPRSA-N |
| XLogP | 3.41 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|