C15H20N2O — CID 115342584
(E)-3-(3-aminophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 115342584) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-aminophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 115342584 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (E)-3-(3-aminophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CC1CCCCN1C(=O)/C=C/c1cccc(N)c1 |
| InChI | InChI=1S/C15H20N2O/c1-12-5-2-3-10-17(12)15(18)9-8-13-6-4-7-14(16)11-13/h4,6-9,11-12H,2-3,5,10,16H2,1H3/b9-8+ |
| InChIKey | KVMUUYYCVNLOOQ-CMDGGOBGSA-N |
| XLogP | 2.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|