C15H18ClNO — CID 2931190
3-(4-chlorophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 2931190) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2931190 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2-methylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CC1CCCCN1C(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO/c1-12-4-2-3-11-17(12)15(18)10-7-13-5-8-14(16)9-6-13/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | STUCBNRKSRALGB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|