C19H25N — CID 11761331
(3E)-N-cyclohexyl-4-phenyl-2-propan-2-ylbuta-1,3-dien-1-imine (PubChem CID 11761331) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (3E)-N-cyclohexyl-4-phenyl-2-propan-2-ylbuta-1,3-dien-1-imine.
| Compound Name | (3E)-N-cyclohexyl-4-phenyl-2-propan-2-ylbuta-1,3-dien-1-imine |
|---|---|
| PubChem CID | 11761331 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (3E)-N-cyclohexyl-4-phenyl-2-propan-2-ylbuta-1,3-dien-1-imine |
| SMILES | CC(C)C(=C=NC1CCCCC1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-16(2)18(14-13-17-9-5-3-6-10-17)15-20-19-11-7-4-8-12-19/h3,5-6,9-10,13-14,16,19H,4,7-8,11-12H2,1-2H3/b14-13+ |
| InChIKey | JNNSGQLZESCDRD-BUHFOSPRSA-N |
| XLogP | 5.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|