C20H23N — CID 140968860
N-cyclohexyl-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine (PubChem CID 140968860) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-cyclohexyl-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | N-cyclohexyl-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 140968860 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-cyclohexyl-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine |
| SMILES | C1=C/C(=N\C2CCCCC2)C(C=Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C20H23N/c1-3-9-17(10-4-1)15-16-18-11-7-8-14-20(18)21-19-12-5-2-6-13-19/h1,3-4,7-11,14-16,18-19H,2,5-6,12-13H2/b16-15?,21-20+ |
| InChIKey | RWWWDBKYEDSWRB-BJCWSORCSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|