C16H19NOSe — CID 102073486
(4E)-4-benzylidene-N-cyclohexyl-1,3-oxaselenolan-2-imine (PubChem CID 102073486) has the molecular formula C16H19NOSe and a molecular weight of 320.29 g/mol. Its IUPAC name is (4E)-4-benzylidene-N-cyclohexyl-1,3-oxaselenolan-2-imine.
| Compound Name | (4E)-4-benzylidene-N-cyclohexyl-1,3-oxaselenolan-2-imine |
|---|---|
| PubChem CID | 102073486 |
| Molecular Formula | C16H19NOSe |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (4E)-4-benzylidene-N-cyclohexyl-1,3-oxaselenolan-2-imine |
| SMILES | C(=C1\CO/C(=N\C2CCCCC2)[Se]1)\c1ccccc1 |
| InChI | InChI=1S/C16H19NOSe/c1-3-7-13(8-4-1)11-15-12-18-16(19-15)17-14-9-5-2-6-10-14/h1,3-4,7-8,11,14H,2,5-6,9-10,12H2/b15-11+,17-16+ |
| InChIKey | UHUCZMRHYMHTFR-YRICKYJRSA-N |
| XLogP | 3.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|