C20H22N2O — CID 16626234
(E)-1-(2-cyclohexylimino-1-pyridinyl)-3-phenylprop-2-en-1-one (PubChem CID 16626234) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (E)-1-(2-cyclohexylimino-1-pyridinyl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(2-cyclohexylimino-1-pyridinyl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 16626234 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (E)-1-(2-cyclohexylimino-1-pyridinyl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)n1cccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C20H22N2O/c23-20(15-14-17-9-3-1-4-10-17)22-16-8-7-13-19(22)21-18-11-5-2-6-12-18/h1,3-4,7-10,13-16,18H,2,5-6,11-12H2/b15-14+,21-19+ |
| InChIKey | VUKNXSLYBSODLD-KPPKKHFCSA-N |
| XLogP | 4.08 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|