C24H31N3O3S — CID 16605071
4-[(E)-3-(2-cyclohexylimino-1-pyridinyl)-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide (PubChem CID 16605071) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 4-[(E)-3-(2-cyclohexylimino-1-pyridinyl)-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-(2-cyclohexylimino-1-pyridinyl)-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 16605071 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 4-[(E)-3-(2-cyclohexylimino-1-pyridinyl)-3-oxoprop-1-enyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)n2cccc/c2=N\C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-3-26(4-2)31(29,30)22-16-13-20(14-17-22)15-18-24(28)27-19-9-8-12-23(27)25-21-10-6-5-7-11-21/h8-9,12-19,21H,3-7,10-11H2,1-2H3/b18-15+,25-23+ |
| InChIKey | GUWOZEUSEYIRDM-LXFXVVTESA-N |
| XLogP | 4.11 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|