C24H35N3O4S — CID 55784142
N,N-diethyl-4-[(E)-3-oxo-3-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide (PubChem CID 55784142) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-3-oxo-3-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(E)-3-oxo-3-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55784142 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N,N-diethyl-4-[(E)-3-oxo-3-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)N2CCC(CC(=O)N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H35N3O4S/c1-3-27(4-2)32(30,31)22-10-7-20(8-11-22)9-12-23(28)26-17-13-21(14-18-26)19-24(29)25-15-5-6-16-25/h7-12,21H,3-6,13-19H2,1-2H3/b12-9+ |
| InChIKey | KYPNNCBLZDBLMK-FMIVXFBMSA-N |
| XLogP | 2.98 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|