C18H18F2N2O — CID 16626252
(2-cyclohexylimino-1-pyridinyl)-(2,4-difluorophenyl)methanone (PubChem CID 16626252) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is (2-cyclohexylimino-1-pyridinyl)-(2,4-difluorophenyl)methanone.
| Compound Name | (2-cyclohexylimino-1-pyridinyl)-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 16626252 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2-cyclohexylimino-1-pyridinyl)-(2,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1F)n1cccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C18H18F2N2O/c19-13-9-10-15(16(20)12-13)18(23)22-11-5-4-8-17(22)21-14-6-2-1-3-7-14/h4-5,8-12,14H,1-3,6-7H2/b21-17+ |
| InChIKey | SAQIAEIZKUDLPH-HEHNFIMWSA-N |
| XLogP | 3.69 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |