C19H20F2N2O2 — CID 16626285
(2-cyclohexylimino-1-pyridinyl)-[2-(difluoromethoxy)phenyl]methanone (PubChem CID 16626285) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is (2-cyclohexylimino-1-pyridinyl)-[2-(difluoromethoxy)phenyl]methanone.
| Compound Name | (2-cyclohexylimino-1-pyridinyl)-[2-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 16626285 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2-cyclohexylimino-1-pyridinyl)-[2-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)F)n1cccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C19H20F2N2O2/c20-19(21)25-16-11-5-4-10-15(16)18(24)23-13-7-6-12-17(23)22-14-8-2-1-3-9-14/h4-7,10-14,19H,1-3,8-9H2/b22-17+ |
| InChIKey | BCCPVUMTSZIWPC-OQKWZONESA-N |
| XLogP | 4.01 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |