C20H24N4O2 — CID 166188653
(2-cyclohexylimino-1-pyridinyl)-[5-(cyclopropylmethoxy)pyrazin-2-yl]methanone (PubChem CID 166188653) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2-cyclohexylimino-1-pyridinyl)-[5-(cyclopropylmethoxy)pyrazin-2-yl]methanone.
| Compound Name | (2-cyclohexylimino-1-pyridinyl)-[5-(cyclopropylmethoxy)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 166188653 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2-cyclohexylimino-1-pyridinyl)-[5-(cyclopropylmethoxy)pyrazin-2-yl]methanone |
| SMILES | O=C(c1cnc(OCC2CC2)cn1)n1cccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C20H24N4O2/c25-20(17-12-22-19(13-21-17)26-14-15-9-10-15)24-11-5-4-8-18(24)23-16-6-2-1-3-7-16/h4-5,8,11-13,15-16H,1-3,6-7,9-10,14H2/b23-18+ |
| InChIKey | CPQFDUNSAYCMFS-PTGBLXJZSA-N |
| XLogP | 2.99 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |