C18H17ClF2N2O — CID 16626260
(2-chloro-4,5-difluorophenyl)-(2-cyclohexylimino-1-pyridinyl)methanone (PubChem CID 16626260) has the molecular formula C18H17ClF2N2O and a molecular weight of 350.80 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-(2-cyclohexylimino-1-pyridinyl)methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-(2-cyclohexylimino-1-pyridinyl)methanone |
|---|---|
| PubChem CID | 16626260 |
| Molecular Formula | C18H17ClF2N2O |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-(2-cyclohexylimino-1-pyridinyl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)n1cccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C18H17ClF2N2O/c19-14-11-16(21)15(20)10-13(14)18(24)23-9-5-4-8-17(23)22-12-6-2-1-3-7-12/h4-5,8-12H,1-3,6-7H2/b22-17+ |
| InChIKey | FFUPZZVAINSDLR-OQKWZONESA-N |
| XLogP | 4.34 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|