C13H16Cl2F2N2O — CID 119468475
[2-(aminomethyl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride (PubChem CID 119468475) has the molecular formula C13H16Cl2F2N2O and a molecular weight of 325.19 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119468475 |
| Molecular Formula | C13H16Cl2F2N2O |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride |
| SMILES | Cl.NCC1CCCCN1C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H15ClF2N2O.ClH/c14-10-6-12(16)11(15)5-9(10)13(19)18-4-2-1-3-8(18)7-17;/h5-6,8H,1-4,7,17H2;1H |
| InChIKey | JDNHSMLIKQJPRD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|