C12H15ClN2O — CID 81482963
[2-(aminomethyl)pyrrolidin-1-yl]-(2-chlorophenyl)methanone (PubChem CID 81482963) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(2-chlorophenyl)methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 81482963 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(2-chlorophenyl)methanone |
| SMILES | NCC1CCCN1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2O/c13-11-6-2-1-5-10(11)12(16)15-7-3-4-9(15)8-14/h1-2,5-6,9H,3-4,7-8,14H2 |
| InChIKey | UTOMRSQKMDOJHO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |