C12H14ClIN2O — CID 119632203
[2-(aminomethyl)pyrrolidin-1-yl]-(2-chloro-4-iodophenyl)methanone (PubChem CID 119632203) has the molecular formula C12H14ClIN2O and a molecular weight of 364.61 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(2-chloro-4-iodophenyl)methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(2-chloro-4-iodophenyl)methanone |
|---|---|
| PubChem CID | 119632203 |
| Molecular Formula | C12H14ClIN2O |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(2-chloro-4-iodophenyl)methanone |
| SMILES | NCC1CCCN1C(=O)c1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H14ClIN2O/c13-11-6-8(14)3-4-10(11)12(17)16-5-1-2-9(16)7-15/h3-4,6,9H,1-2,5,7,15H2 |
| InChIKey | JDJNEGZVZBPSKN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|