C13H16Cl3FN2O — CID 119466333
[2-(aminomethyl)piperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone;hydrochloride (PubChem CID 119466333) has the molecular formula C13H16Cl3FN2O and a molecular weight of 341.64 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119466333 |
| Molecular Formula | C13H16Cl3FN2O |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-(2,4-dichloro-5-fluorophenyl)methanone;hydrochloride |
| SMILES | Cl.NCC1CCCCN1C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2FN2O.ClH/c14-10-6-11(15)12(16)5-9(10)13(19)18-4-2-1-3-8(18)7-17;/h5-6,8H,1-4,7,17H2;1H |
| InChIKey | UALFHPKYRBQMAZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|