C14H18ClIN2O — CID 119435609
[2-(1-aminoethyl)piperidin-1-yl]-(2-chloro-4-iodophenyl)methanone (PubChem CID 119435609) has the molecular formula C14H18ClIN2O and a molecular weight of 392.67 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-(2-chloro-4-iodophenyl)methanone.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-(2-chloro-4-iodophenyl)methanone |
|---|---|
| PubChem CID | 119435609 |
| Molecular Formula | C14H18ClIN2O |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-(2-chloro-4-iodophenyl)methanone |
| SMILES | CC(N)C1CCCCN1C(=O)c1ccc(I)cc1Cl |
| InChI | InChI=1S/C14H18ClIN2O/c1-9(17)13-4-2-3-7-18(13)14(19)11-6-5-10(16)8-12(11)15/h5-6,8-9,13H,2-4,7,17H2,1H3 |
| InChIKey | JWJJOEMBAMPRGQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|