C13H18ClN3O — CID 66483593
[2-(1-aminoethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone (PubChem CID 66483593) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 66483593 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone |
| SMILES | CC(N)C1CCCCN1C(=O)c1ccncc1Cl |
| InChI | InChI=1S/C13H18ClN3O/c1-9(15)12-4-2-3-7-17(12)13(18)10-5-6-16-8-11(10)14/h5-6,8-9,12H,2-4,7,15H2,1H3 |
| InChIKey | NEFRVDHBQGOZMB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |